C18H17N3O3 — CID 110653773
methyl 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzoate (PubChem CID 110653773) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzoate.
| Compound Name | methyl 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 110653773 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | methyl 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCCc2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-23-18(22)14-7-9-15(10-8-14)19-12-11-16-20-21-17(24-16)13-5-3-2-4-6-13/h2-10,19H,11-12H2,1H3 |
| InChIKey | ZXURCXXBRLDZJY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |