C19H19N3O2 — CID 108812578
1-(2-ethyl-6-methylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812578) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(2-ethyl-6-methylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(2-ethyl-6-methylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812578 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-(2-ethyl-6-methylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | CCc1cccc(C)c1NC(=O)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C19H19N3O2/c1-3-14-11-7-8-13(2)18(14)21-19(23)20-17-12-16(24-22-17)15-9-5-4-6-10-15/h4-12H,3H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | VWGOSSPKBHYNDP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |