C20H21N3O2 — CID 108812503
1-(2-methyl-6-propan-2-ylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812503) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(2-methyl-6-propan-2-ylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(2-methyl-6-propan-2-ylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812503 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(2-methyl-6-propan-2-ylphenyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H21N3O2/c1-13(2)16-11-7-8-14(3)19(16)22-20(24)21-18-12-17(25-23-18)15-9-5-4-6-10-15/h4-13H,1-3H3,(H2,21,22,23,24) |
| InChIKey | YUHRKQZLCQTWHD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |