C11H9F3N4O2 — CID 51135954
1-(5-methyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluoroanilino)urea (PubChem CID 51135954) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluoroanilino)urea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluoroanilino)urea |
|---|---|
| PubChem CID | 51135954 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(2,3,4-trifluoroanilino)urea |
| SMILES | Cc1cc(NC(=O)NNc2ccc(F)c(F)c2F)no1 |
| InChI | InChI=1S/C11H9F3N4O2/c1-5-4-8(18-20-5)15-11(19)17-16-7-3-2-6(12)9(13)10(7)14/h2-4,16H,1H3,(H2,15,17,18,19) |
| InChIKey | CSVJXDCDHGVWSK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|