C19H13F3N2O — CID 108867200
1-(4-phenylphenyl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108867200) has the molecular formula C19H13F3N2O and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(4-phenylphenyl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108867200 |
| Molecular Formula | C19H13F3N2O |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-(4-phenylphenyl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H13F3N2O/c20-15-10-11-16(18(22)17(15)21)24-19(25)23-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H2,23,24,25) |
| InChIKey | UZUKREGVIZDHMJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|