C20H15F3N2O2 — CID 108992623
1-(4-phenylmethoxyphenyl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108992623) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-(4-phenylmethoxyphenyl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(4-phenylmethoxyphenyl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108992623 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-(4-phenylmethoxyphenyl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H15F3N2O2/c21-16-10-11-17(19(23)18(16)22)25-20(26)24-14-6-8-15(9-7-14)27-12-13-4-2-1-3-5-13/h1-11H,12H2,(H2,24,25,26) |
| InChIKey | LHNIYHUQPCLUSC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|