C19H12F3NO — CID 26357388
2-phenyl-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 26357388) has the molecular formula C19H12F3NO and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-phenyl-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 2-phenyl-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 26357388 |
| Molecular Formula | C19H12F3NO |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-phenyl-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H12F3NO/c20-15-10-11-16(18(22)17(15)21)23-19(24)14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-11H,(H,23,24) |
| InChIKey | RCFVDDLTBJVTEX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|