C16H9F3N2O2 — CID 110681510
2-phenyl-N-(2,3,4-trifluorophenyl)-1,3-oxazole-5-carboxamide (PubChem CID 110681510) has the molecular formula C16H9F3N2O2 and a molecular weight of 318.25 g/mol. Its IUPAC name is 2-phenyl-N-(2,3,4-trifluorophenyl)-1,3-oxazole-5-carboxamide.
| Compound Name | 2-phenyl-N-(2,3,4-trifluorophenyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110681510 |
| Molecular Formula | C16H9F3N2O2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-phenyl-N-(2,3,4-trifluorophenyl)-1,3-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H9F3N2O2/c17-10-6-7-11(14(19)13(10)18)21-15(22)12-8-20-16(23-12)9-4-2-1-3-5-9/h1-8H,(H,21,22) |
| InChIKey | KXTUPSSTZTZNIT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|