About 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide
5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide (PubChem CID 43029737) has the molecular formula C17H9ClF3NO2
and a molecular weight of 351.71 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide |
| PubChem CID | 43029737 |
| Molecular Formula | C17H9ClF3NO2 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H9ClF3NO2/c18-10-3-1-9(2-4-10)13-7-8-14(24-13)17(23)22-12-6-5-11(19)15(20)16(12)21/h1-8H,(H,22,23) |
| InChIKey | KJLGIUCVNKSVKS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide (CID 43029737) is 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide is O=C(Nc1ccc(F)c(F)c1F)c1ccc(-c2ccc(Cl)cc2)o1.
What is the InChIKey of 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide?
The InChIKey is KJLGIUCVNKSVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF3NO2/c18-10-3-1-9(2-4-10)13-7-8-14(24-13)17(23)22-12-6-5-11(19)15(20)16(12)21/h1-8H,(H,22,23).
What are the key properties of 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide?
5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide has a molecular weight of 351.71 g/mol, XLogP of 5.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide is sourced from PubChem (CID 43029737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).