C17H9ClF3NO2 — CID 43029737
5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide (PubChem CID 43029737) has the molecular formula C17H9ClF3NO2 and a molecular weight of 351.71 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43029737 |
| Molecular Formula | C17H9ClF3NO2 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2,3,4-trifluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H9ClF3NO2/c18-10-3-1-9(2-4-10)13-7-8-14(24-13)17(23)22-12-6-5-11(19)15(20)16(12)21/h1-8H,(H,22,23) |
| InChIKey | KJLGIUCVNKSVKS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|