C19H16ClNO4 — CID 3393060
5-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)furan-2-carboxamide (PubChem CID 3393060) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3393060 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(-c3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C19H16ClNO4/c1-23-14-7-8-17(24-2)15(11-14)21-19(22)18-10-9-16(25-18)12-3-5-13(20)6-4-12/h3-11H,1-2H3,(H,21,22) |
| InChIKey | GMPHMTFERVOCRI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |