C17H10ClF2NO2 — CID 18208546
5-(4-chlorophenyl)-N-(3,4-difluorophenyl)furan-2-carboxamide (PubChem CID 18208546) has the molecular formula C17H10ClF2NO2 and a molecular weight of 333.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(3,4-difluorophenyl)furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(3,4-difluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 18208546 |
| Molecular Formula | C17H10ClF2NO2 |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3,4-difluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H10ClF2NO2/c18-11-3-1-10(2-4-11)15-7-8-16(23-15)17(22)21-12-5-6-13(19)14(20)9-12/h1-9H,(H,21,22) |
| InChIKey | SYEJQQXDUAYWME-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |