C20H13ClN2O4 — CID 1227268
5-(4-chlorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)furan-2-carboxamide (PubChem CID 1227268) has the molecular formula C20H13ClN2O4 and a molecular weight of 380.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1227268 |
| Molecular Formula | C20H13ClN2O4 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)furan-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3ccc(-c4ccc(Cl)cc4)o3)cc2C1=O |
| InChI | InChI=1S/C20H13ClN2O4/c1-23-19(25)14-7-6-13(10-15(14)20(23)26)22-18(24)17-9-8-16(27-17)11-2-4-12(21)5-3-11/h2-10H,1H3,(H,22,24) |
| InChIKey | DPDILXVAVIFXMM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|