C24H17Cl2NO3 — CID 95733498
N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 95733498) has the molecular formula C24H17Cl2NO3 and a molecular weight of 438.31 g/mol. Its IUPAC name is N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95733498 |
| Molecular Formula | C24H17Cl2NO3 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-[4-chloro-2-[(S)-hydroxy(phenyl)methyl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1[C@@H](O)c1ccccc1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C24H17Cl2NO3/c25-17-8-6-15(7-9-17)21-12-13-22(30-21)24(29)27-20-11-10-18(26)14-19(20)23(28)16-4-2-1-3-5-16/h1-14,23,28H,(H,27,29)/t23-/m0/s1 |
| InChIKey | JKSLZFQEEHPTQR-QHCPKHFHSA-N |
| XLogP | 6.59 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |