C24H17BrClNO3 — CID 50882532
5-(2-bromophenyl)-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]furan-2-carboxamide (PubChem CID 50882532) has the molecular formula C24H17BrClNO3 and a molecular weight of 482.76 g/mol. Its IUPAC name is 5-(2-bromophenyl)-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(2-bromophenyl)-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 50882532 |
| Molecular Formula | C24H17BrClNO3 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 5-(2-bromophenyl)-N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(O)c1ccccc1)c1ccc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C24H17BrClNO3/c25-19-9-5-4-8-17(19)21-12-13-22(30-21)24(29)27-20-11-10-16(26)14-18(20)23(28)15-6-2-1-3-7-15/h1-14,23,28H,(H,27,29) |
| InChIKey | GEZJEHQSWUJJEO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |