C21H12F3N3O2 — CID 43038343
4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 43038343) has the molecular formula C21H12F3N3O2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 43038343 |
| Molecular Formula | C21H12F3N3O2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H12F3N3O2/c22-15-10-11-16(18(24)17(15)23)25-19(28)12-6-8-14(9-7-12)21-27-26-20(29-21)13-4-2-1-3-5-13/h1-11H,(H,25,28) |
| InChIKey | FKVNJBGAJLBWRD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|