C21H16N3O2P — CID 170150882
N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phosphanylbenzamide (PubChem CID 170150882) has the molecular formula C21H16N3O2P and a molecular weight of 373.35 g/mol. Its IUPAC name is N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phosphanylbenzamide.
| Compound Name | N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phosphanylbenzamide |
|---|---|
| PubChem CID | 170150882 |
| Molecular Formula | C21H16N3O2P |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-4-phosphanylbenzamide |
| SMILES | O=C(Nc1ccc(-c2nnc(-c3ccccc3)o2)cc1)c1ccc(P)cc1 |
| InChI | InChI=1S/C21H16N3O2P/c25-19(14-8-12-18(27)13-9-14)22-17-10-6-16(7-11-17)21-24-23-20(26-21)15-4-2-1-3-5-15/h1-13H,27H2,(H,22,25) |
| InChIKey | YSYVHSMVJTZPOW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|