C18H13F3N4O3S — CID 16537165
2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 16537165) has the molecular formula C18H13F3N4O3S and a molecular weight of 422.39 g/mol. Its IUPAC name is 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 16537165 |
| Molecular Formula | C18H13F3N4O3S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2-[[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)o1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H13F3N4O3S/c19-11-6-7-12(16(21)15(11)20)23-13(26)8-22-14(27)9-29-18-25-24-17(28-18)10-4-2-1-3-5-10/h1-7H,8-9H2,(H,22,27)(H,23,26) |
| InChIKey | OIGWKWCHRRTPPA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|