C25H19F3N4O2S — CID 2532162
2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2532162) has the molecular formula C25H19F3N4O2S and a molecular weight of 496.51 g/mol. Its IUPAC name is 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2532162 |
| Molecular Formula | C25H19F3N4O2S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C25H19F3N4O2S/c26-17-11-12-18(22(28)21(17)27)30-19(33)13-29-20(34)14-35-25-31-23(15-7-3-1-4-8-15)24(32-25)16-9-5-2-6-10-16/h1-12H,13-14H2,(H,29,34)(H,30,33)(H,31,32) |
| InChIKey | UWIBGEDSLONXQI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|