C25H21N3O3S — CID 39922393
methyl 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 39922393) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is methyl 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39922393 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | methyl 2-[[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C25H21N3O3S/c1-31-24(30)19-14-8-9-15-20(19)26-21(29)16-32-25-27-22(17-10-4-2-5-11-17)23(28-25)18-12-6-3-7-13-18/h2-15H,16H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | JXPHBZNDQZHRKB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |