C17H19N3O4S — CID 135438244
methyl 2-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 135438244) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is methyl 2-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135438244 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl 2-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCc1c(C)nc(SCC(=O)Nc2ccccc2C(=O)OC)[nH]c1=O |
| InChI | InChI=1S/C17H19N3O4S/c1-4-11-10(2)18-17(20-15(11)22)25-9-14(21)19-13-8-6-5-7-12(13)16(23)24-3/h5-8H,4,9H2,1-3H3,(H,19,21)(H,18,20,22) |
| InChIKey | SSXWXWRQEMJDPL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |