C17H17F3N4O3S — CID 135849307
2-[[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 135849307) has the molecular formula C17H17F3N4O3S and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 135849307 |
| Molecular Formula | C17H17F3N4O3S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C17H17F3N4O3S/c1-2-3-9-6-12(25)24-17(22-9)28-8-14(27)21-7-13(26)23-11-5-4-10(18)15(19)16(11)20/h4-6H,2-3,7-8H2,1H3,(H,21,27)(H,23,26)(H,22,24,25) |
| InChIKey | DBHJTYSJFQPRGI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|