C15H14F3N3O2S — CID 136684677
2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 136684677) has the molecular formula C15H14F3N3O2S and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 136684677 |
| Molecular Formula | C15H14F3N3O2S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(C)c1cc(=O)[nH]c(SCC(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C15H14F3N3O2S/c1-7(2)10-5-11(22)21-15(20-10)24-6-12(23)19-9-4-3-8(16)13(17)14(9)18/h3-5,7H,6H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | IBEUJPREJYSNGQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|