C20H25N3O4S — CID 136684737
butyl 3-[[2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 136684737) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is butyl 3-[[2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | butyl 3-[[2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 136684737 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | butyl 3-[[2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)CSc2nc(C(C)C)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-4-5-9-27-19(26)14-7-6-8-15(10-14)21-18(25)12-28-20-22-16(13(2)3)11-17(24)23-20/h6-8,10-11,13H,4-5,9,12H2,1-3H3,(H,21,25)(H,22,23,24) |
| InChIKey | YPMJGAYFMBDWKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|