C14H22N2O3S — CID 136684934
pentyl 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 136684934) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is pentyl 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | pentyl 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 136684934 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | pentyl 2-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSc1nc(C(C)C)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H22N2O3S/c1-4-5-6-7-19-13(18)9-20-14-15-11(10(2)3)8-12(17)16-14/h8,10H,4-7,9H2,1-3H3,(H,15,16,17) |
| InChIKey | DPKFPJJIQHUOPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|