C11H16N2O3S — CID 136684492
propyl 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 136684492) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is propyl 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | propyl 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 136684492 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | propyl 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | CCCOC(=O)CSc1nc(CC)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H16N2O3S/c1-3-5-16-10(15)7-17-11-12-8(4-2)6-9(14)13-11/h6H,3-5,7H2,1-2H3,(H,12,13,14) |
| InChIKey | LOQNMAGOYKYEOU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |