C15H16N2O3S2 — CID 136686998
ethyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]acetate (PubChem CID 136686998) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 136686998 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | ethyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc(CSc2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H16N2O3S2/c1-2-20-14(19)10-22-15-16-11(8-13(18)17-15)9-21-12-6-4-3-5-7-12/h3-8H,2,9-10H2,1H3,(H,16,17,18) |
| InChIKey | SXNBNXYJAFSHOY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |