C21H20N2O3S2 — CID 136687112
benzyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoate (PubChem CID 136687112) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is benzyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoate.
| Compound Name | benzyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 136687112 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | benzyl 2-[[6-oxo-4-(phenylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoate |
| SMILES | CC(Sc1nc(CSc2ccccc2)cc(=O)[nH]1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-15(20(25)26-13-16-8-4-2-5-9-16)28-21-22-17(12-19(24)23-21)14-27-18-10-6-3-7-11-18/h2-12,15H,13-14H2,1H3,(H,22,23,24) |
| InChIKey | XJRDMYYMOGXUCC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |