C17H17N3O3S — CID 135552815
benzyl (2R)-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate (PubChem CID 135552815) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is benzyl (2R)-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate.
| Compound Name | benzyl (2R)-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 135552815 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | benzyl (2R)-2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate |
| SMILES | CCc1nc(S[C@H](C)C(=O)OCc2ccccc2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C17H17N3O3S/c1-3-14-13(9-18)15(21)20-17(19-14)24-11(2)16(22)23-10-12-7-5-4-6-8-12/h4-8,11H,3,10H2,1-2H3,(H,19,20,21)/t11-/m1/s1 |
| InChIKey | RRFDJVIJHIBXBC-LLVKDONJSA-N |
| XLogP | 2.43 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|