C16H14Cl2N4O2S — CID 135972505
2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3,5-dichlorophenyl)propanamide (PubChem CID 135972505) has the molecular formula C16H14Cl2N4O2S and a molecular weight of 397.29 g/mol. Its IUPAC name is 2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3,5-dichlorophenyl)propanamide.
| Compound Name | 2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 135972505 |
| Molecular Formula | C16H14Cl2N4O2S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-[(5-cyano-4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(3,5-dichlorophenyl)propanamide |
| SMILES | CCc1nc(SC(C)C(=O)Nc2cc(Cl)cc(Cl)c2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C16H14Cl2N4O2S/c1-3-13-12(7-19)15(24)22-16(21-13)25-8(2)14(23)20-11-5-9(17)4-10(18)6-11/h4-6,8H,3H2,1-2H3,(H,20,23)(H,21,22,24) |
| InChIKey | YMPLQTYZQODZPT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|