C23H21ClN4O2S — CID 135938003
(2S)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-ethyl-6-methylphenyl)propanamide (PubChem CID 135938003) has the molecular formula C23H21ClN4O2S and a molecular weight of 452.97 g/mol. Its IUPAC name is (2S)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-ethyl-6-methylphenyl)propanamide.
| Compound Name | (2S)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-ethyl-6-methylphenyl)propanamide |
|---|---|
| PubChem CID | 135938003 |
| Molecular Formula | C23H21ClN4O2S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (2S)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-N-(2-ethyl-6-methylphenyl)propanamide |
| SMILES | CCc1cccc(C)c1NC(=O)[C@H](C)Sc1nc(-c2ccc(Cl)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C23H21ClN4O2S/c1-4-15-7-5-6-13(2)19(15)26-21(29)14(3)31-23-27-20(18(12-25)22(30)28-23)16-8-10-17(24)11-9-16/h5-11,14H,4H2,1-3H3,(H,26,29)(H,27,28,30)/t14-/m0/s1 |
| InChIKey | VXPHAPXKUVORRX-AWEZNQCLSA-N |
| XLogP | 4.95 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|