C22H19ClN4O4S — CID 163326086
methyl 4-[2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate;hydrochloride (PubChem CID 163326086) has the molecular formula C22H19ClN4O4S and a molecular weight of 470.94 g/mol. Its IUPAC name is methyl 4-[2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate;hydrochloride.
| Compound Name | methyl 4-[2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 163326086 |
| Molecular Formula | C22H19ClN4O4S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | methyl 4-[2-[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]propanoylamino]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(NC(=O)C(C)Sc2nc(-c3ccccc3)c(C#N)c(=O)[nH]2)cc1.Cl |
| InChI | InChI=1S/C22H18N4O4S.ClH/c1-13(19(27)24-16-10-8-15(9-11-16)21(29)30-2)31-22-25-18(14-6-4-3-5-7-14)17(12-23)20(28)26-22;/h3-11,13H,1-2H3,(H,24,27)(H,25,26,28);1H |
| InChIKey | YBOFZWNIXJMZON-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|