C25H21N3O3S — CID 23942557
4-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propanoylamino]benzoic acid (PubChem CID 23942557) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propanoylamino]benzoic acid.
| Compound Name | 4-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 23942557 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propanoylamino]benzoic acid |
| SMILES | CC(Sc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-16(23(29)26-20-14-12-19(13-15-20)24(30)31)32-25-27-21(17-8-4-2-5-9-17)22(28-25)18-10-6-3-7-11-18/h2-16H,1H3,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | KWJLWUBUCCVRGC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |