C21H16Cl2N4O2S — CID 135938007
(2S)-N-(5-chloro-2-methylphenyl)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanamide (PubChem CID 135938007) has the molecular formula C21H16Cl2N4O2S and a molecular weight of 459.36 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-methylphenyl)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(5-chloro-2-methylphenyl)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 135938007 |
| Molecular Formula | C21H16Cl2N4O2S |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (2S)-N-(5-chloro-2-methylphenyl)-2-[[4-(4-chlorophenyl)-5-cyano-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@H](C)Sc1nc(-c2ccc(Cl)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C21H16Cl2N4O2S/c1-11-3-6-15(23)9-17(11)25-19(28)12(2)30-21-26-18(16(10-24)20(29)27-21)13-4-7-14(22)8-5-13/h3-9,12H,1-2H3,(H,25,28)(H,26,27,29)/t12-/m0/s1 |
| InChIKey | ATLDHJZBWWNWOD-LBPRGKRZSA-N |
| XLogP | 5.04 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|