C13H10ClN3OS — CID 135667133
4-(4-chlorophenyl)-2-ethylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135667133) has the molecular formula C13H10ClN3OS and a molecular weight of 291.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-ethylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-2-ethylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135667133 |
| Molecular Formula | C13H10ClN3OS |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 4-(4-chlorophenyl)-2-ethylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCSc1nc(-c2ccc(Cl)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H10ClN3OS/c1-2-19-13-16-11(10(7-15)12(18)17-13)8-3-5-9(14)6-4-8/h3-6H,2H2,1H3,(H,16,17,18) |
| InChIKey | SYZJUQFHOBKQJT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|