C19H15N3OS2 — CID 168587622
2-methylsulfanyl-4-[4-(4-methylsulfanylphenyl)phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168587622) has the molecular formula C19H15N3OS2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-methylsulfanyl-4-[4-(4-methylsulfanylphenyl)phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-4-[4-(4-methylsulfanylphenyl)phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168587622 |
| Molecular Formula | C19H15N3OS2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-methylsulfanyl-4-[4-(4-methylsulfanylphenyl)phenyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1ccc(-c2ccc(-c3nc(SC)[nH]c(=O)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C19H15N3OS2/c1-24-15-9-7-13(8-10-15)12-3-5-14(6-4-12)17-16(11-20)18(23)22-19(21-17)25-2/h3-10H,1-2H3,(H,21,22,23) |
| InChIKey | PLQRSBFISIZRLL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|