C13H11N3O3S2 — CID 168587492
2-methylsulfanyl-4-(4-methylsulfonylphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168587492) has the molecular formula C13H11N3O3S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(4-methylsulfonylphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-4-(4-methylsulfonylphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168587492 |
| Molecular Formula | C13H11N3O3S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-methylsulfanyl-4-(4-methylsulfonylphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(S(C)(=O)=O)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H11N3O3S2/c1-20-13-15-11(10(7-14)12(17)16-13)8-3-5-9(6-4-8)21(2,18)19/h3-6H,1-2H3,(H,15,16,17) |
| InChIKey | WXXYCEAWWKROQG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|