C17H17N3OSSi — CID 168589151
2-methylsulfanyl-6-oxo-4-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168589151) has the molecular formula C17H17N3OSSi and a molecular weight of 339.50 g/mol. Its IUPAC name is 2-methylsulfanyl-6-oxo-4-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-6-oxo-4-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589151 |
| Molecular Formula | C17H17N3OSSi |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-methylsulfanyl-6-oxo-4-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(C#C[Si](C)(C)C)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N3OSSi/c1-22-17-19-15(14(11-18)16(21)20-17)13-7-5-12(6-8-13)9-10-23(2,3)4/h5-8H,1-4H3,(H,19,20,21) |
| InChIKey | IWRVDTKXUPFFHP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|