C18H12FN3O2S — CID 168589485
4-[4-(4-fluorophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589485) has the molecular formula C18H12FN3O2S and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[4-(4-fluorophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[4-(4-fluorophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589485 |
| Molecular Formula | C18H12FN3O2S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-[4-(4-fluorophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(Oc3ccc(F)cc3)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C18H12FN3O2S/c1-25-18-21-16(15(10-20)17(23)22-18)11-2-6-13(7-3-11)24-14-8-4-12(19)5-9-14/h2-9H,1H3,(H,21,22,23) |
| InChIKey | VUKKWSBTMLYOQI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|