C12H7F2N3OS — CID 168588034
4-(3,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588034) has the molecular formula C12H7F2N3OS and a molecular weight of 279.27 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588034 |
| Molecular Formula | C12H7F2N3OS |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 4-(3,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(F)cc(F)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H7F2N3OS/c1-19-12-16-10(9(5-15)11(18)17-12)6-2-7(13)4-8(14)3-6/h2-4H,1H3,(H,16,17,18) |
| InChIKey | ORAKGZYPZFFNBP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|