C13H9FIN3OS — CID 168588404
4-(3-fluoro-5-iodo-4-methylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588404) has the molecular formula C13H9FIN3OS and a molecular weight of 401.20 g/mol. Its IUPAC name is 4-(3-fluoro-5-iodo-4-methylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-fluoro-5-iodo-4-methylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588404 |
| Molecular Formula | C13H9FIN3OS |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 400.95 |
| IUPAC Name | 4-(3-fluoro-5-iodo-4-methylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(F)c(C)c(I)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H9FIN3OS/c1-6-9(14)3-7(4-10(6)15)11-8(5-16)12(19)18-13(17-11)20-2/h3-4H,1-2H3,(H,17,18,19) |
| InChIKey | HAUVEWPMXUPQGQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|