C13H6F2N4OS — CID 168589069
4-(4-cyano-2,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589069) has the molecular formula C13H6F2N4OS and a molecular weight of 304.28 g/mol. Its IUPAC name is 4-(4-cyano-2,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-cyano-2,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589069 |
| Molecular Formula | C13H6F2N4OS |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-(4-cyano-2,5-difluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(F)c(C#N)cc2F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H6F2N4OS/c1-21-13-18-11(8(5-17)12(20)19-13)7-3-9(14)6(4-16)2-10(7)15/h2-3H,1H3,(H,18,19,20) |
| InChIKey | QAQPVWGXSPZDBE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|