C12H5BrF3N3OS — CID 168588860
4-(3-bromo-2,5,6-trifluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588860) has the molecular formula C12H5BrF3N3OS and a molecular weight of 376.16 g/mol. Its IUPAC name is 4-(3-bromo-2,5,6-trifluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-bromo-2,5,6-trifluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588860 |
| Molecular Formula | C12H5BrF3N3OS |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 4-(3-bromo-2,5,6-trifluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2c(F)c(F)cc(Br)c2F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H5BrF3N3OS/c1-21-12-18-10(4(3-17)11(20)19-12)7-8(15)5(13)2-6(14)9(7)16/h2H,1H3,(H,18,19,20) |
| InChIKey | YIIJLSJLPFJUOT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|