C12H6BrClFN3OS — CID 168588792
4-(3-bromo-4-chloro-2-fluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588792) has the molecular formula C12H6BrClFN3OS and a molecular weight of 374.62 g/mol. Its IUPAC name is 4-(3-bromo-4-chloro-2-fluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-bromo-4-chloro-2-fluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588792 |
| Molecular Formula | C12H6BrClFN3OS |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | 4-(3-bromo-4-chloro-2-fluorophenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(Cl)c(Br)c2F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H6BrClFN3OS/c1-20-12-17-10(6(4-16)11(19)18-12)5-2-3-7(14)8(13)9(5)15/h2-3H,1H3,(H,17,18,19) |
| InChIKey | FQANGSYVDFVJFU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|