C12H7BrClN3O2S — CID 168588360
4-(2-bromo-3-chloro-6-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588360) has the molecular formula C12H7BrClN3O2S and a molecular weight of 372.63 g/mol. Its IUPAC name is 4-(2-bromo-3-chloro-6-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2-bromo-3-chloro-6-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588360 |
| Molecular Formula | C12H7BrClN3O2S |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 370.91 |
| IUPAC Name | 4-(2-bromo-3-chloro-6-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2c(O)ccc(Cl)c2Br)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H7BrClN3O2S/c1-20-12-16-10(5(4-15)11(19)17-12)8-7(18)3-2-6(14)9(8)13/h2-3,18H,1H3,(H,16,17,19) |
| InChIKey | SNBFUBDCLKBWBG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|