C13H10BrN3O3S — CID 168587650
4-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168587650) has the molecular formula C13H10BrN3O3S and a molecular weight of 368.21 g/mol. Its IUPAC name is 4-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168587650 |
| Molecular Formula | C13H10BrN3O3S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 4-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(Br)c(-c2nc(SC)[nH]c(=O)c2C#N)cc1O |
| InChI | InChI=1S/C13H10BrN3O3S/c1-20-10-4-8(14)6(3-9(10)18)11-7(5-15)12(19)17-13(16-11)21-2/h3-4,18H,1-2H3,(H,16,17,19) |
| InChIKey | RJBTXLQLOUNMNY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|