C17H16BrN3O5S — CID 168589164
methyl 2-[5-bromo-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]acetate (PubChem CID 168589164) has the molecular formula C17H16BrN3O5S and a molecular weight of 454.30 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168589164 |
| Molecular Formula | C17H16BrN3O5S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | methyl 2-[5-bromo-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(-c2nc(SC)[nH]c(=O)c2C#N)c(Br)cc1OCC(=O)OC |
| InChI | InChI=1S/C17H16BrN3O5S/c1-4-25-12-5-9(11(18)6-13(12)26-8-14(22)24-2)15-10(7-19)16(23)21-17(20-15)27-3/h5-6H,4,8H2,1-3H3,(H,20,21,23) |
| InChIKey | OTVLFBQXUVAUOU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|