C18H20BrN3O3S — CID 168589318
4-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589318) has the molecular formula C18H20BrN3O3S and a molecular weight of 438.35 g/mol. Its IUPAC name is 4-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589318 |
| Molecular Formula | C18H20BrN3O3S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 4-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCCCOc1c(Br)cc(-c2nc(SC)[nH]c(=O)c2C#N)cc1OCC |
| InChI | InChI=1S/C18H20BrN3O3S/c1-4-6-7-25-16-13(19)8-11(9-14(16)24-5-2)15-12(10-20)17(23)22-18(21-15)26-3/h8-9H,4-7H2,1-3H3,(H,21,22,23) |
| InChIKey | HKBMXDDWOAMIEK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|