C28H41N3O3S — CID 168588732
4-(3,4-dioctoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588732) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is 4-(3,4-dioctoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3,4-dioctoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588732 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 4-(3,4-dioctoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCCCCCCCOc1ccc(-c2nc(SC)[nH]c(=O)c2C#N)cc1OCCCCCCCC |
| InChI | InChI=1S/C28H41N3O3S/c1-4-6-8-10-12-14-18-33-24-17-16-22(20-25(24)34-19-15-13-11-9-7-5-2)26-23(21-29)27(32)31-28(30-26)35-3/h16-17,20H,4-15,18-19H2,1-3H3,(H,30,31,32) |
| InChIKey | HCQKWYUMCXZSRV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|