C15H14N4O4S — CID 168587737
2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetamide (PubChem CID 168587737) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is 2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 168587737 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(-c2nc(SC)[nH]c(=O)c2C#N)ccc1OCC(N)=O |
| InChI | InChI=1S/C15H14N4O4S/c1-22-11-5-8(3-4-10(11)23-7-12(17)20)13-9(6-16)14(21)19-15(18-13)24-2/h3-5H,7H2,1-2H3,(H2,17,20)(H,18,19,21) |
| InChIKey | BPXKCEWWIYMPOJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|