C18H13N3O5S — CID 168589741
[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 168589741) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is [4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 168589741 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(-c2nc(SC)[nH]c(=O)c2C#N)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C18H13N3O5S/c1-24-14-8-10(15-11(9-19)16(22)21-18(20-15)27-2)5-6-12(14)26-17(23)13-4-3-7-25-13/h3-8H,1-2H3,(H,20,21,22) |
| InChIKey | ZXLZFEXDBHXSJD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|